Compound Q&A

What are the physical and chemical properties of Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1)?

Answer

Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate
Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1) is a colorless to slightly yellowish liquid with a molecular weight of approximately 635.4 g/mol. It is poorly soluble in water but miscible with many organic solvents. Chemically, it is highly reactive due to its multiple bromine and bromomethyl groups, making it suitable for a range of applications in polymer chemistry and flame retardants.

About

CAS No 19186-97-1
English Name Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate
Molecular Formula C15H24Br9O4P
Molecular Weight 1018.46 g/mol
SMILES C(C(CBr)(CBr)CBr)OP(=O)(OCC(CBr)(CBr)CBr)OCC(CBr)(CBr)CBr
InChIKey BHYQWBKCXBXPKM-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1) typically synthesized?

Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate is typically synthesized through a series of reac...

Compound Q&A

What industries use Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1)?

Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1) is widely used in the polymer i...

Compound Q&A

What precautions should be taken when handling Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1)?

When handling Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...