Compound Q&A

How is Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1) typically synthesized?

Answer

Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate
Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate is typically synthesized through a series of reactions involving bromination and phosphate esterification. Commonly, 1,3-dibromopropane is brominated and then reacted with phosphorus oxychloride or phosphorus pentoxide to form the desired phosphate ester. The reaction is typically carried out under anhydrous conditions and requires careful control of temperature and time to achieve high yields.

About

CAS No 19186-97-1
English Name Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate
Molecular Formula C15H24Br9O4P
Molecular Weight 1018.46 g/mol
SMILES C(C(CBr)(CBr)CBr)OP(=O)(OCC(CBr)(CBr)CBr)OCC(CBr)(CBr)CBr
InChIKey BHYQWBKCXBXPKM-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1)?

Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1) is a colorless to slightly yell...

Compound Q&A

What industries use Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1)?

Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1) is widely used in the polymer i...

Compound Q&A

What precautions should be taken when handling Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1)?

When handling Tris[3-bromo-2,2-bis(bromomethyl)propyl] phosphate (CAS: 19186-97-1), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...