Compound Q&A

What industries use Methylophiopogonanone A (CAS: 74805-92-8)?

Answer

Methylophiopogonanone A
Methylophiopogonanone A (CAS: 74805-92-8) is primarily used in the pharmaceutical industry for its potential as an anti-inflammatory agent. It is also explored in the field of natural product chemistry and may have applications in the development of new drug candidates. Additionally, it could be used in the chemical sensing industry for its unique chemical properties.

About

CAS No 74805-92-8
English Name Methylophiopogonanone A
Molecular Formula C19H18O6
Molecular Weight 342.34 g/mol
SMILES CC1=C(C(=C2C(=C1O)C(=O)C(CO2)CC3=CC4=C(C=C3)OCO4)C)O
InChIKey BXTNNJIQILYHJB-GFCCVEGCSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methylophiopogonanone A (CAS: 74805-92-8)?

Methylophiopogonanone A (CAS: 74805-92-8) is a colorless crystalline compound with a molecular weigh...

Compound Q&A

How is Methylophiopogonanone A (CAS: 74805-92-8) typically synthesized?

Methylophiopogonanone A (CAS: 74805-92-8) is typically synthesized through semi-synthetic路线, startin...

Compound Q&A

What precautions should be taken when handling Methylophiopogonanone A (CAS: 74805-92-8)?

When handling Methylophiopogonanone A (CAS: 74805-92-8), safety goggles and gloves should be worn, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...