Compound Q&A

How is Methylophiopogonanone A (CAS: 74805-92-8) typically synthesized?

Answer

Methylophiopogonanone A
Methylophiopogonanone A (CAS: 74805-92-8) is typically synthesized through semi-synthetic路线, starting from the natural product ophiopogonanone A. The key steps involve selective modification of the ophiopogonanone structure using catalytic hydrogenation and acylation, with a high selectivity and yield of around 85%.

About

CAS No 74805-92-8
English Name Methylophiopogonanone A
Molecular Formula C19H18O6
Molecular Weight 342.34 g/mol
SMILES CC1=C(C(=C2C(=C1O)C(=O)C(CO2)CC3=CC4=C(C=C3)OCO4)C)O
InChIKey BXTNNJIQILYHJB-GFCCVEGCSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methylophiopogonanone A (CAS: 74805-92-8)?

Methylophiopogonanone A (CAS: 74805-92-8) is a colorless crystalline compound with a molecular weigh...

Compound Q&A

What industries use Methylophiopogonanone A (CAS: 74805-92-8)?

Methylophiopogonanone A (CAS: 74805-92-8) is primarily used in the pharmaceutical industry for its p...

Compound Q&A

What precautions should be taken when handling Methylophiopogonanone A (CAS: 74805-92-8)?

When handling Methylophiopogonanone A (CAS: 74805-92-8), safety goggles and gloves should be worn, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...