Compound Q&A

What are the physical and chemical properties of Methylophiopogonanone A (CAS: 74805-92-8)?

Answer

Methylophiopogonanone A
Methylophiopogonanone A (CAS: 74805-92-8) is a colorless crystalline compound with a molecular weight of approximately 284.32 g/mol. It has low solubility in water but is soluble in common organic solvents like methanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo various transformations, making it useful for synthetic applications.

About

CAS No 74805-92-8
English Name Methylophiopogonanone A
Molecular Formula C19H18O6
Molecular Weight 342.34 g/mol
SMILES CC1=C(C(=C2C(=C1O)C(=O)C(CO2)CC3=CC4=C(C=C3)OCO4)C)O
InChIKey BXTNNJIQILYHJB-GFCCVEGCSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is Methylophiopogonanone A (CAS: 74805-92-8) typically synthesized?

Methylophiopogonanone A (CAS: 74805-92-8) is typically synthesized through semi-synthetic路线, startin...

Compound Q&A

What industries use Methylophiopogonanone A (CAS: 74805-92-8)?

Methylophiopogonanone A (CAS: 74805-92-8) is primarily used in the pharmaceutical industry for its p...

Compound Q&A

What precautions should be taken when handling Methylophiopogonanone A (CAS: 74805-92-8)?

When handling Methylophiopogonanone A (CAS: 74805-92-8), safety goggles and gloves should be worn, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...