Compound Q&A

What precautions should be taken when handling (1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene)-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium (CAS: 301224-40-8)?

Answer

[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium
Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be performed in a fume hood. In case of a spill, it should be cleaned up immediately with appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed information on handling and disposal.

About

English Name [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium
Molecular Formula C31H38Cl2N2ORu
Molecular Weight 626.62 g/mol
SMILES CC(OC1=CC=CC=C1C=[Ru+2]=C2N(C3=C(C)C=C(C)C=C3C)CCN2C4=C(C)C=C(C)C=C4C)C.[Cl-].[Cl-]
InChIKey ZRPFJAPZDXQHSM-UHFFFAOYSA-L
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene)-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium (CAS: 301224-40-8)?

The compound has a crystalline form with a molecular weight of approximately 856.09 g/mol. It is poo...

Compound Q&A

How is (1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene)-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium (CAS: 301224-40-8) typically synthesized?

The compound is typically synthesized through a multistep process involving the reaction of rutheniu...

Compound Q&A

What industries use (1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene)-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium (CAS: 301224-40-8)?

This compound is used primarily in the pharmaceutical industry for its catalytic properties in organ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...