Compound Q&A

What are the physical and chemical properties of (1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene)-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium (CAS: 301224-40-8)?

Answer

[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium
The compound has a crystalline form with a molecular weight of approximately 856.09 g/mol. It is poorly soluble in common organic solvents. The compound shows moderate reactivity, particularly towards reducing agents. It can undergo thermal decomposition and is known to form complexes with ruthenium, exhibiting unique spectroscopic and catalytic properties.

About

English Name [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium
Molecular Formula C31H38Cl2N2ORu
Molecular Weight 626.62 g/mol
SMILES CC(OC1=CC=CC=C1C=[Ru+2]=C2N(C3=C(C)C=C(C)C=C3C)CCN2C4=C(C)C=C(C)C=C4C)C.[Cl-].[Cl-]
InChIKey ZRPFJAPZDXQHSM-UHFFFAOYSA-L
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is (1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene)-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium (CAS: 301224-40-8) typically synthesized?

The compound is typically synthesized through a multistep process involving the reaction of rutheniu...

Compound Q&A

What industries use (1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene)-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium (CAS: 301224-40-8)?

This compound is used primarily in the pharmaceutical industry for its catalytic properties in organ...

Compound Q&A

What precautions should be taken when handling (1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene)-dichloro-[(2-isopropoxyphenyl)methylene]ruthenium (CAS: 301224-40-8)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...