Compound Q&A

What industries use (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7)?

Answer

(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide
(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) is used in the pharmaceutical industry for the synthesis of certain organic compounds, in polymer science for the modification of polymers, and in analytical chemistry for the development of sensors and as a reagent in various chemical reactions. It is also used in the semiconductor industry for the production of advanced materials.

About

CAS No 30018-16-7
English Name (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide
Molecular Formula C23H24BrO2P
Molecular Weight 443.3 g/mol
SMILES CCOC(=O)C(C)[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
InChIKey RSYXORMKBUFAMS-UHFFFAOYSA-M
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7)?

(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) is a crystalline compoun...

Compound Q&A

How is (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) typically synthesized?

(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) is typically synthesized...

Compound Q&A

What precautions should be taken when handling (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7)?

When handling (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7), safety go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...