Compound Q&A

What are the physical and chemical properties of (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7)?

Answer

(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide
(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) is a crystalline compound with a molecular weight of approximately 431.25 g/mol. It has a low solubility in water but is soluble in organic solvents. Chemically, it is relatively stable but can react with strong bases. It is commonly used in organic synthesis and as a reagent in various chemical reactions.

About

CAS No 30018-16-7
English Name (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide
Molecular Formula C23H24BrO2P
Molecular Weight 443.3 g/mol
SMILES CCOC(=O)C(C)[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
InChIKey RSYXORMKBUFAMS-UHFFFAOYSA-M
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) typically synthesized?

(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) is typically synthesized...

Compound Q&A

What industries use (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7)?

(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) is used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7)?

When handling (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7), safety go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...