Compound Q&A

How is (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) typically synthesized?

Answer

(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide
(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) is typically synthesized through the reaction of ethoxyacetyl triphenyl phosphonium bromide with triphenylphosphine. The reaction involves the substitution of the ethoxy group, and the process can be catalyzed by various organic bases. The yield is generally high, and the product is purified by recrystallization.

About

CAS No 30018-16-7
English Name (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide
Molecular Formula C23H24BrO2P
Molecular Weight 443.3 g/mol
SMILES CCOC(=O)C(C)[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
InChIKey RSYXORMKBUFAMS-UHFFFAOYSA-M
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7)?

(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) is a crystalline compoun...

Compound Q&A

What industries use (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7)?

(1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7) is used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7)?

When handling (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide (CAS: 30018-16-7), safety go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...