Compound Q&A

What industries use Benzene-1,2,4-triyl triacetate (CAS: 613-03-6)?

Answer

Benzene-1,2,4-triyl triacetate
Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) is used in various industries, particularly in the production of pharmaceuticals, where it serves as a precursor for certain medications. It is also utilized in the synthesis of polymers and in the development of sensors and semiconductors due to its chemical reactivity and stability.

About

CAS No 613-03-6
English Name Benzene-1,2,4-triyl triacetate
Molecular Formula C12H12O6
Molecular Weight 252.22 g/mol
SMILES CC(=O)Oc1ccc(OC(=O)C)c(OC(=O)C)c1
InChIKey AESFGSJWSUZRGW-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzene-1,2,4-triyl triacetate (CAS: 613-03-6)?

Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) is a crystalline compound with a molecular weight of ...

Compound Q&A

How is Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) typically synthesized?

Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) is typically synthesized through the acetylation of 1...

Compound Q&A

What precautions should be taken when handling Benzene-1,2,4-triyl triacetate (CAS: 613-03-6)?

When handling Benzene-1,2,4-triyl triacetate (CAS: 613-03-6), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...