Compound Q&A

How is Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) typically synthesized?

Answer

Benzene-1,2,4-triyl triacetate
Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) is typically synthesized through the acetylation of 1,2,4-benzenetriol. The reaction involves the use of acetic anhydride or acetyl chloride in the presence of a catalyst like concentrated sulfuric acid. The yield is usually high, and the product is purified by recrystallization from organic solvents.

About

CAS No 613-03-6
English Name Benzene-1,2,4-triyl triacetate
Molecular Formula C12H12O6
Molecular Weight 252.22 g/mol
SMILES CC(=O)Oc1ccc(OC(=O)C)c(OC(=O)C)c1
InChIKey AESFGSJWSUZRGW-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzene-1,2,4-triyl triacetate (CAS: 613-03-6)?

Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) is a crystalline compound with a molecular weight of ...

Compound Q&A

What industries use Benzene-1,2,4-triyl triacetate (CAS: 613-03-6)?

Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) is used in various industries, particularly in the pr...

Compound Q&A

What precautions should be taken when handling Benzene-1,2,4-triyl triacetate (CAS: 613-03-6)?

When handling Benzene-1,2,4-triyl triacetate (CAS: 613-03-6), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...