Compound Q&A

What are the physical and chemical properties of Benzene-1,2,4-triyl triacetate (CAS: 613-03-6)?

Answer

Benzene-1,2,4-triyl triacetate
Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) is a crystalline compound with a molecular weight of approximately 312.33 g/mol. It has a low solubility in water but is soluble in common organic solvents. Chemically, it is highly reactive towards nucleophiles and exhibits ester group chemistry. This compound is known for its stability under normal conditions but should be handled with care due to its chemical reactivity.

About

CAS No 613-03-6
English Name Benzene-1,2,4-triyl triacetate
Molecular Formula C12H12O6
Molecular Weight 252.22 g/mol
SMILES CC(=O)Oc1ccc(OC(=O)C)c(OC(=O)C)c1
InChIKey AESFGSJWSUZRGW-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) typically synthesized?

Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) is typically synthesized through the acetylation of 1...

Compound Q&A

What industries use Benzene-1,2,4-triyl triacetate (CAS: 613-03-6)?

Benzene-1,2,4-triyl triacetate (CAS: 613-03-6) is used in various industries, particularly in the pr...

Compound Q&A

What precautions should be taken when handling Benzene-1,2,4-triyl triacetate (CAS: 613-03-6)?

When handling Benzene-1,2,4-triyl triacetate (CAS: 613-03-6), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...