Compound Q&A

What precautions should be taken when handling Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3)?

Answer

Zinc bis(O,O-diheptyl phosphorodithioate)
When handling Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure that the work is conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate absorbent materials and proper disposal methods. Always refer to the Safety Data Sheet (SDS) for specific handling and storage instructions to ensure safety.

About

CAS No 68649-42-3
English Name Zinc bis(O,O-diheptyl phosphorodithioate)
Molecular Formula C28H60O4P2S4Zn
Molecular Weight 716.4 g/mol
SMILES CCCCCCCOP(=S)(OCCCCCCC)[S-].CCCCCCCOP(=S)(OCCCCCCC)[S-].[Zn+2]
InChIKey ZKAQFYDDTYGBBV-UHFFFAOYSA-L
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3)?

Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) is a crystalline compound with a molecul...

Compound Q&A

How is Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) typically synthesized?

Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) is typically synthesized by the reaction...

Compound Q&A

What industries use Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3)?

Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) is utilized in various industries, inclu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...