Compound Q&A

What industries use Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3)?

Answer

Zinc bis(O,O-diheptyl phosphorodithioate)
Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) is utilized in various industries, including pharmaceuticals as an intermediate in the synthesis of certain drugs, in polymers for its stabilizing properties, in sensors for its sensing capabilities, and in semiconductors for its reactivity with metal surfaces. Its wide range of applications highlights its importance in modern chemical industries.

About

CAS No 68649-42-3
English Name Zinc bis(O,O-diheptyl phosphorodithioate)
Molecular Formula C28H60O4P2S4Zn
Molecular Weight 716.4 g/mol
SMILES CCCCCCCOP(=S)(OCCCCCCC)[S-].CCCCCCCOP(=S)(OCCCCCCC)[S-].[Zn+2]
InChIKey ZKAQFYDDTYGBBV-UHFFFAOYSA-L
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3)?

Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) is a crystalline compound with a molecul...

Compound Q&A

How is Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) typically synthesized?

Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) is typically synthesized by the reaction...

Compound Q&A

What precautions should be taken when handling Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3)?

When handling Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...