Compound Q&A

How is Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) typically synthesized?

Answer

Zinc bis(O,O-diheptyl phosphorodithioate)
Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) is typically synthesized by the reaction of diheptyl phosphorodithioic acid with zinc oxide in the presence of a suitable solvent. The process involves careful temperature control and the use of a catalyst to achieve the desired selectivity and yield. The reaction mixture is then purified by recrystallization or other suitable methods to obtain the final product.

About

CAS No 68649-42-3
English Name Zinc bis(O,O-diheptyl phosphorodithioate)
Molecular Formula C28H60O4P2S4Zn
Molecular Weight 716.4 g/mol
SMILES CCCCCCCOP(=S)(OCCCCCCC)[S-].CCCCCCCOP(=S)(OCCCCCCC)[S-].[Zn+2]
InChIKey ZKAQFYDDTYGBBV-UHFFFAOYSA-L
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3)?

Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) is a crystalline compound with a molecul...

Compound Q&A

What industries use Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3)?

Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3) is utilized in various industries, inclu...

Compound Q&A

What precautions should be taken when handling Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3)?

When handling Zinc bis(O,O-diheptyl phosphorodithioate) (CAS: 68649-42-3), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...