Compound Q&A

How is 4-Fluoro-3-nitroaniline (CAS: 364-76-1) typically synthesized?

Answer

4-Fluoro-3-nitroaniline
4-Fluoro-3-nitroaniline can be synthesized through the nitration of 4-fluoroaniline followed by the reduction of the nitro group. Commonly, nitric acid and sulfuric acid are used as reagents for nitration, and sodium borohydride or other similar reducing agents are employed for the reduction step. The process involves several steps and requires precise control of temperature and reaction conditions to achieve high selectivity and yield.

About

CAS No 364-76-1
English Name 4-Fluoro-3-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C=C1N)[N+](=O)[O-])F
InChIKey LLIOADBCFIXIEU-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Fluoro-3-nitroaniline (CAS: 364-76-1)?

4-Fluoro-3-nitroaniline is a crystalline solid with a molecular weight of approximately 174.04 g/mol...

Compound Q&A

What industries use 4-Fluoro-3-nitroaniline (CAS: 364-76-1)?

4-Fluoro-3-nitroaniline is primarily used in the pharmaceutical industry for the synthesis of variou...

Compound Q&A

What precautions should be taken when handling 4-Fluoro-3-nitroaniline (CAS: 364-76-1)?

When handling 4-Fluoro-3-nitroaniline, ensure the use of personal protective equipment such as glove...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...