Compound Q&A

What are the physical and chemical properties of 4-Fluoro-3-nitroaniline (CAS: 364-76-1)?

Answer

4-Fluoro-3-nitroaniline
4-Fluoro-3-nitroaniline is a crystalline solid with a molecular weight of approximately 174.04 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. The compound is known for its mild reactivity, particularly towards nucleophilic substitution reactions. It has a melting point of about 105-107°C and is stable under normal storage conditions but should be handled with care due to its reactivity.

About

CAS No 364-76-1
English Name 4-Fluoro-3-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C=C1N)[N+](=O)[O-])F
InChIKey LLIOADBCFIXIEU-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is 4-Fluoro-3-nitroaniline (CAS: 364-76-1) typically synthesized?

4-Fluoro-3-nitroaniline can be synthesized through the nitration of 4-fluoroaniline followed by the ...

Compound Q&A

What industries use 4-Fluoro-3-nitroaniline (CAS: 364-76-1)?

4-Fluoro-3-nitroaniline is primarily used in the pharmaceutical industry for the synthesis of variou...

Compound Q&A

What precautions should be taken when handling 4-Fluoro-3-nitroaniline (CAS: 364-76-1)?

When handling 4-Fluoro-3-nitroaniline, ensure the use of personal protective equipment such as glove...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...