Compound Q&A

What industries use Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1)?

Answer

Benzyl 2,2,2-trichloroethanimidate
Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1) is used in various industries, primarily in the pharmaceutical and polymer sectors. It serves as a key intermediate in the synthesis of drug molecules and is also utilized in the preparation of certain polymers and functional materials. Its use in sensors and semiconductors is limited but is explored for specific applications.

About

CAS No 81927-55-1
English Name Benzyl 2,2,2-trichloroethanimidate
Molecular Formula C9H8Cl3NO
Molecular Weight 252.53 g/mol
SMILES C1=CC=C(C=C1)COC(=N)C(Cl)(Cl)Cl
InChIKey HUZCTWYDQIQZPM-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1)?

Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1) is a white crystalline solid with a molecular w...

Compound Q&A

How is Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1) typically synthesized?

Benzyl 2,2,2-trichloroethanimidate is typically synthesized by reacting 2,2,2-trichloroethanamine wi...

Compound Q&A

What precautions should be taken when handling Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1)?

When handling Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1), it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...