Compound Q&A

How is Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1) typically synthesized?

Answer

Benzyl 2,2,2-trichloroethanimidate
Benzyl 2,2,2-trichloroethanimidate is typically synthesized by reacting 2,2,2-trichloroethanamine with benzyl chloroformate in the presence of a base such as triethylamine. The reaction proceeds via a nucleophilic acyl substitution, yielding the imidate ester. The yield is usually around 85-90%, and the reaction is carried out under anhydrous conditions to minimize side reactions.

About

CAS No 81927-55-1
English Name Benzyl 2,2,2-trichloroethanimidate
Molecular Formula C9H8Cl3NO
Molecular Weight 252.53 g/mol
SMILES C1=CC=C(C=C1)COC(=N)C(Cl)(Cl)Cl
InChIKey HUZCTWYDQIQZPM-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1)?

Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1) is a white crystalline solid with a molecular w...

Compound Q&A

What industries use Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1)?

Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1) is used in various industries, primarily in the...

Compound Q&A

What precautions should be taken when handling Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1)?

When handling Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1), it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...