Compound Q&A

What are the physical and chemical properties of Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1)?

Answer

Benzyl 2,2,2-trichloroethanimidate
Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1) is a white crystalline solid with a molecular weight of approximately 279.03 g/mol. It is virtually insoluble in water but soluble in organic solvents such as diethyl ether and chloroform. The compound is relatively stable under normal conditions but can react with bases to form chloroacetamide derivatives. It is used as a precursor in organic synthesis and as a protective group reagent.

About

CAS No 81927-55-1
English Name Benzyl 2,2,2-trichloroethanimidate
Molecular Formula C9H8Cl3NO
Molecular Weight 252.53 g/mol
SMILES C1=CC=C(C=C1)COC(=N)C(Cl)(Cl)Cl
InChIKey HUZCTWYDQIQZPM-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1) typically synthesized?

Benzyl 2,2,2-trichloroethanimidate is typically synthesized by reacting 2,2,2-trichloroethanamine wi...

Compound Q&A

What industries use Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1)?

Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1) is used in various industries, primarily in the...

Compound Q&A

What precautions should be taken when handling Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1)?

When handling Benzyl 2,2,2-trichloroethanimidate (CAS: 81927-55-1), it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...