Compound Q&A

What industries use 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one (CAS: 491-71-4)?

Answer

5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one
5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one is used in the pharmaceutical industry for the development of drugs targeting various ailments. It is also used in the polymer industry for synthesizing functional polymers and in the sensor industry for developing chemical and biological sensors. Additionally, it can be employed in the semiconductor industry for manufacturing organic light-emitting diodes (OLEDs).

About

CAS No 491-71-4
English Name 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one
Molecular Formula C16H12O6
Molecular Weight 300.27 g/mol
SMILES COc1cc(ccc1O)c2cc(=O)c3c(O)cc(O)cc3o2
InChIKey SCZVLDHREVKTSH-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one (CAS: 491-71-4)?

5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one is a yellow crystalline compound with a...

Compound Q&A

How is 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one (CAS: 491-71-4) typically synthesized?

5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one can be synthesized through multistep or...

Compound Q&A

What precautions should be taken when handling 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one (CAS: 491-71-4)?

Proper personal protective equipment (PPE) is essential when handling 5,7-Dihydroxy-2-(4-hydroxy-3-m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...