Compound Q&A

What are the physical and chemical properties of 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one (CAS: 491-71-4)?

Answer

5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one
5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one is a yellow crystalline compound with a molecular weight of approximately 318.23 g/mol. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetone. The compound is moderately reactive and can undergo hydrolysis and condensation reactions under certain conditions.

About

CAS No 491-71-4
English Name 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one
Molecular Formula C16H12O6
Molecular Weight 300.27 g/mol
SMILES COc1cc(ccc1O)c2cc(=O)c3c(O)cc(O)cc3o2
InChIKey SCZVLDHREVKTSH-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one (CAS: 491-71-4) typically synthesized?

5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one can be synthesized through multistep or...

Compound Q&A

What industries use 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one (CAS: 491-71-4)?

5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one (CAS: 491-71-4)?

Proper personal protective equipment (PPE) is essential when handling 5,7-Dihydroxy-2-(4-hydroxy-3-m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...