Compound Q&A

What industries use [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8)?

Answer

[29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc
This compound is used in various industries. In pharmaceuticals, it can serve as a colorant and material in drug formulations. In polymer science, it is used as a coloring agent and to enhance adhesion. It also finds applications in sensor technology, semiconductors, and as a photostabilizer in polymer materials.

About

CAS No 14320-04-8
English Name [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc
Molecular Formula C32H16N8Zn
Molecular Weight 577.9 g/mol
SMILES C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Zn+2]
InChIKey PODBBOVVOGJETB-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8)?

The compound [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc is a solid with a crystalline fo...

Compound Q&A

How is [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8) typically synthesized?

This compound is typically synthesized through a multistep process involving the condensation of zin...

Compound Q&A

What precautions should be taken when handling [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8)?

When handling this compound, wear appropriate personal protective equipment (PPE) such as gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...