Compound Q&A

How is [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8) typically synthesized?

Answer

[29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc
This compound is typically synthesized through a multistep process involving the condensation of zinc acetate with the phthalocyanine precursor. The synthesis requires the use of appropriate solvents and temperature control, and the yield can be improved by using specific catalysts such as piperidine. The product is purified by recrystallization or chromatography.

About

CAS No 14320-04-8
English Name [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc
Molecular Formula C32H16N8Zn
Molecular Weight 577.9 g/mol
SMILES C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Zn+2]
InChIKey PODBBOVVOGJETB-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8)?

The compound [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc is a solid with a crystalline fo...

Compound Q&A

What industries use [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8)?

This compound is used in various industries. In pharmaceuticals, it can serve as a colorant and mate...

Compound Q&A

What precautions should be taken when handling [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8)?

When handling this compound, wear appropriate personal protective equipment (PPE) such as gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...