Compound Q&A

What are the physical and chemical properties of [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8)?

Answer

[29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc
The compound [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc is a solid with a crystalline form. Its molecular weight is approximately 696.55 g/mol. It has poor water solubility but good solubility in organic solvents like chloroform and benzene. Chemically, it is relatively stable but can undergo substitution reactions under certain conditions.

About

CAS No 14320-04-8
English Name [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc
Molecular Formula C32H16N8Zn
Molecular Weight 577.9 g/mol
SMILES C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Zn+2]
InChIKey PODBBOVVOGJETB-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8) typically synthesized?

This compound is typically synthesized through a multistep process involving the condensation of zin...

Compound Q&A

What industries use [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8)?

This compound is used in various industries. In pharmaceuticals, it can serve as a colorant and mate...

Compound Q&A

What precautions should be taken when handling [29H,31H-Phthalocyaninato(2-)-kappa~2~N~29~,N~31~]zinc (CAS: 14320-04-8)?

When handling this compound, wear appropriate personal protective equipment (PPE) such as gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...