Compound Q&A

How is Apixaban Impurity 19 (CAS: 503615-07-4) typically synthesized?

Answer

Apixaban Impurity 19
Apixaban Impurity 19 (CAS: 503615-07-4) is synthesized through a series of reaction steps involving organic transformations, including coupling reactions and acetylation. The synthesis typically requires the use of azeotropic drying and recrystallization techniques to purify the product. Yield and selectivity are crucial in this process, and common reagents include dichloromethane, acetic anhydride, and triethylamine.

About

English Name Apixaban Impurity 19
Molecular Formula C22H22N4O4
Molecular Weight 406.44 g/mol
SMILES O=C(C1=NN(C2=CC=C(OC)C=C2)C3=C1CCN(C4=CC=C(N)C=C4)C3=O)OCC
InChIKey UVAQGQOGOJLALA-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Apixaban Impurity 19 (CAS: 503615-07-4)?

Apixaban Impurity 19 (CAS: 503615-07-4) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

What industries use Apixaban Impurity 19 (CAS: 503615-07-4)?

Apixaban Impurity 19 (CAS: 503615-07-4) is primarily used in the pharmaceutical industry, specifical...

Compound Q&A

What precautions should be taken when handling Apixaban Impurity 19 (CAS: 503615-07-4)?

When handling Apixaban Impurity 19 (CAS: 503615-07-4), it is essential to use personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...