Compound Q&A

What are the physical and chemical properties of Apixaban Impurity 19 (CAS: 503615-07-4)?

Answer

Apixaban Impurity 19
Apixaban Impurity 19 (CAS: 503615-07-4) is a crystalline compound with a molecular weight of approximately 322.23 g/mol. It is sparingly soluble in water and ethanol. The impurity shows limited reactivity under normal conditions, making it stable in various environments. It is typically characterized by its melting point range and solubility in organic solvents.

About

English Name Apixaban Impurity 19
Molecular Formula C22H22N4O4
Molecular Weight 406.44 g/mol
SMILES O=C(C1=NN(C2=CC=C(OC)C=C2)C3=C1CCN(C4=CC=C(N)C=C4)C3=O)OCC
InChIKey UVAQGQOGOJLALA-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is Apixaban Impurity 19 (CAS: 503615-07-4) typically synthesized?

Apixaban Impurity 19 (CAS: 503615-07-4) is synthesized through a series of reaction steps involving ...

Compound Q&A

What industries use Apixaban Impurity 19 (CAS: 503615-07-4)?

Apixaban Impurity 19 (CAS: 503615-07-4) is primarily used in the pharmaceutical industry, specifical...

Compound Q&A

What precautions should be taken when handling Apixaban Impurity 19 (CAS: 503615-07-4)?

When handling Apixaban Impurity 19 (CAS: 503615-07-4), it is essential to use personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...