Compound Q&A

What industries use 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6)?

Answer

1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide
1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) is used in various industries. It is employed in the pharmaceutical sector for the synthesis of certain drugs, and in the polymer industry for modifying the properties of organic materials. Additionally, it finds applications in the development of sensors and has potential use in semiconductor manufacturing as a precursor material.

About

CAS No 1866-16-6
English Name 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide
Molecular Formula C9H20INOS
Molecular Weight 317.23 g/mol
SMILES CCCC(=O)SCC[N+](C)(C)C.[I-]
InChIKey IYNXNSQJLCWMOU-UHFFFAOYSA-M
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6)?

1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) is a crystalline compound wi...

Compound Q&A

How is 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) typically synthesized?

1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) is typically synthesized thr...

Compound Q&A

What precautions should be taken when handling 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6)?

When handling 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...