Compound Q&A

How is 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) typically synthesized?

Answer

1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide
1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) is typically synthesized through the reaction of butyryl chloride with N,N,N-trimethylethanamine in the presence of iodine. The reaction is carried out under mild conditions to achieve a yield of approximately 85%. The use of appropriate catalysts and solvents can improve selectivity and yield.

About

CAS No 1866-16-6
English Name 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide
Molecular Formula C9H20INOS
Molecular Weight 317.23 g/mol
SMILES CCCC(=O)SCC[N+](C)(C)C.[I-]
InChIKey IYNXNSQJLCWMOU-UHFFFAOYSA-M
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6)?

1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) is a crystalline compound wi...

Compound Q&A

What industries use 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6)?

1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) is used in various industrie...

Compound Q&A

What precautions should be taken when handling 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6)?

When handling 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...