Compound Q&A

What are the physical and chemical properties of 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6)?

Answer

1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide
1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) is a crystalline compound with a molecular weight of approximately 305.38 g/mol. It is slightly soluble in water and has good solubility in organic solvents. Chemically, it is mildly reactive with strong bases and can form precipitates under certain conditions. The compound is stable under normal laboratory conditions but requires careful handling to avoid degradation.

About

CAS No 1866-16-6
English Name 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide
Molecular Formula C9H20INOS
Molecular Weight 317.23 g/mol
SMILES CCCC(=O)SCC[N+](C)(C)C.[I-]
InChIKey IYNXNSQJLCWMOU-UHFFFAOYSA-M
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) typically synthesized?

1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) is typically synthesized thr...

Compound Q&A

What industries use 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6)?

1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6) is used in various industrie...

Compound Q&A

What precautions should be taken when handling 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6)?

When handling 1-(Butyrylsulfanyl)-N,N,N-trimethylethanaminium iodide (CAS: 1866-16-6), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...