Compound Q&A

What industries use 3,3'-Dibromobiphenyl (CAS: 16400-51-4)?

Answer

3,3'-Dibromobiphenyl
3,3'-Dibromobiphenyl is primarily used in the pharmaceutical industry for the production of certain drugs and intermediates. It is also utilized in the synthesis of dyes and pigments. Additionally, it is employed in the polymer industry as a flame retardant additive and in the production of electronic materials such as sensors and semiconductor devices.

About

CAS No 16400-51-4
English Name 3,3'-Dibromobiphenyl
Molecular Formula C12H8Br2
Molecular Weight 312 g/mol
SMILES C1=CC(=CC(=C1)Br)C2=CC(=CC=C2)Br
InChIKey LPLLWKZDMKTEMV-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,3'-Dibromobiphenyl (CAS: 16400-51-4)?

3,3'-Dibromobiphenyl (CAS: 16400-51-4) is a crystalline solid with a high melting point of around 28...

Compound Q&A

How is 3,3'-Dibromobiphenyl (CAS: 16400-51-4) typically synthesized?

3,3'-Dibromobiphenyl can be synthesized through the bromination of biphenyl using bromine and a Lewi...

Compound Q&A

What precautions should be taken when handling 3,3'-Dibromobiphenyl (CAS: 16400-51-4)?

When handling 3,3'-Dibromobiphenyl, it is crucial to wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...