Compound Q&A

How is 3,3'-Dibromobiphenyl (CAS: 16400-51-4) typically synthesized?

Answer

3,3'-Dibromobiphenyl
3,3'-Dibromobiphenyl can be synthesized through the bromination of biphenyl using bromine and a Lewis acid catalyst such as aluminum bromide. The reaction typically proceeds with high selectivity and moderate yield. The biphenyl is dissolved in a solvent like benzene or toluene, and the bromination step is carried out at a temperature of around 100°C.

About

CAS No 16400-51-4
English Name 3,3'-Dibromobiphenyl
Molecular Formula C12H8Br2
Molecular Weight 312 g/mol
SMILES C1=CC(=CC(=C1)Br)C2=CC(=CC=C2)Br
InChIKey LPLLWKZDMKTEMV-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,3'-Dibromobiphenyl (CAS: 16400-51-4)?

3,3'-Dibromobiphenyl (CAS: 16400-51-4) is a crystalline solid with a high melting point of around 28...

Compound Q&A

What industries use 3,3'-Dibromobiphenyl (CAS: 16400-51-4)?

3,3'-Dibromobiphenyl is primarily used in the pharmaceutical industry for the production of certain ...

Compound Q&A

What precautions should be taken when handling 3,3'-Dibromobiphenyl (CAS: 16400-51-4)?

When handling 3,3'-Dibromobiphenyl, it is crucial to wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...