Compound Q&A

What are the physical and chemical properties of 3,3'-Dibromobiphenyl (CAS: 16400-51-4)?

Answer

3,3'-Dibromobiphenyl
3,3'-Dibromobiphenyl (CAS: 16400-51-4) is a crystalline solid with a high melting point of around 288°C. It has a molecular weight of approximately 318.07 g/mol. The compound is slightly soluble in common organic solvents such as ethanol and acetone but is generally insoluble in water. Chemically, it is less reactive than bromobenzene but can undergo reactions such as electrophilic aromatic substitution, making it useful in organic synthesis.

About

CAS No 16400-51-4
English Name 3,3'-Dibromobiphenyl
Molecular Formula C12H8Br2
Molecular Weight 312 g/mol
SMILES C1=CC(=CC(=C1)Br)C2=CC(=CC=C2)Br
InChIKey LPLLWKZDMKTEMV-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 3,3'-Dibromobiphenyl (CAS: 16400-51-4) typically synthesized?

3,3'-Dibromobiphenyl can be synthesized through the bromination of biphenyl using bromine and a Lewi...

Compound Q&A

What industries use 3,3'-Dibromobiphenyl (CAS: 16400-51-4)?

3,3'-Dibromobiphenyl is primarily used in the pharmaceutical industry for the production of certain ...

Compound Q&A

What precautions should be taken when handling 3,3'-Dibromobiphenyl (CAS: 16400-51-4)?

When handling 3,3'-Dibromobiphenyl, it is crucial to wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...