Compound Q&A

What precautions should be taken when handling 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate (CAS: 135042-17-0)?

Answer

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate
When handling 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. Work should be conducted in a well-ventilated area or a fume hood due to its potential to release volatile compounds. In case of a spill, immediately clean up using appropriate absorbents and consult the Safety Data Sheet (SDS) for specific instructions. Always ensure proper storage in a cool, dry place away from heat sources and oxidizing agents.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate
Molecular Formula C11H19NO5
Molecular Weight 245.27 g/mol
SMILES COC(=O)[C@H]1C[C@H](O)CN1C(=O)OC(C)(C)C
InChIKey MZMNEDXVUJLQAF-JGVFFNPUSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate (CAS: 135042-17-0)?

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate is a crystalline com...

Compound Q&A

How is 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate (CAS: 135042-17-0) typically synthesized?

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate can be synthesized v...

Compound Q&A

What industries use 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate (CAS: 135042-17-0)?

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate is primarily used in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...