Compound Q&A

What industries use 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate (CAS: 135042-17-0)?

Answer

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate
2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drug molecules. It is also explored in polymer technology for its potential use in the development of advanced materials. Additionally, it may find applications in the production of sensors and semiconductors due to its unique chemical properties.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate
Molecular Formula C11H19NO5
Molecular Weight 245.27 g/mol
SMILES COC(=O)[C@H]1C[C@H](O)CN1C(=O)OC(C)(C)C
InChIKey MZMNEDXVUJLQAF-JGVFFNPUSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate (CAS: 135042-17-0)?

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate is a crystalline com...

Compound Q&A

How is 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate (CAS: 135042-17-0) typically synthesized?

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate can be synthesized v...

Compound Q&A

What precautions should be taken when handling 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate (CAS: 135042-17-0)?

When handling 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-pyrrolidinedicarboxylate, it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...