Compound Q&A

What industries use (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0)?

Answer

(2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid
(2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0) is primarily used in pharmaceuticals and agricultural industries. It serves as a key intermediate in the production of drugs and as a fungicide. Its applications also extend to the development of sensors and other chemical reagents due to its unique chemical properties.

About

CAS No 72217-12-0
English Name (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid
Molecular Formula C5H6N4O3S
Molecular Weight 202.195 g/mol
SMILES CON=C(C1=NSC(=N1)N)C(=O)O
InChIKey OSIJZKVBQPTIMT-WAPJZHGLSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0)?

(2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0) is a crystalline sol...

Compound Q&A

How is (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0) typically synthesized?

(2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0) is synthesized throu...

Compound Q&A

What precautions should be taken when handling (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0)?

Precautions when handling (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...