Compound Q&A

What are the physical and chemical properties of (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0)?

Answer

(2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid
(2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0) is a crystalline solid with a molecular weight of approximately 226.27 g/mol. It is slightly soluble in water and less soluble in common organic solvents. Chemically, the compound is known for its reactivity with metal ions and its ability to form stable complexes. It also shows good thermal stability, with a melting point around 200°C.

About

CAS No 72217-12-0
English Name (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid
Molecular Formula C5H6N4O3S
Molecular Weight 202.2 g/mol
SMILES CON=C(C1=NSC(=N1)N)C(=O)O
InChIKey OSIJZKVBQPTIMT-WAPJZHGLSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0) typically synthesized?

(2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0) is synthesized throu...

Compound Q&A

What industries use (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0)?

(2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0) is primarily used in...

Compound Q&A

What precautions should be taken when handling (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-12-0)?

Precautions when handling (2Z)-(5-Amino-1,2,4-thiadiazol-3-yl)(methoxyimino)acetic acid (CAS: 72217-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...