Compound Q&A

What precautions should be taken when handling 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

Answer

4,4'-Oxydibenzoyl chloride
Handling 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) requires proper Personal Protective Equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from heat and sources of ignition. Spills should be handled with caution using appropriate spill kits or neutralizing agents. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

CAS No 7158-32-9
English Name 4,4'-Oxydibenzoyl chloride
Molecular Formula C14H8Cl2O3
Molecular Weight 295.12 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)OC2=CC=C(C=C2)C(=O)Cl
InChIKey OSUWBBMPVXVSOA-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) typically synthesized?

4,4'-Oxydibenzoyl chloride is typically synthesized via the reaction of benzoyl chloride with benzoi...

Compound Q&A

What industries use 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) is used in various industries, including pharmaceuticals...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...