Compound Q&A

What industries use 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

Answer

4,4'-Oxydibenzoyl chloride
4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) is used in various industries, including pharmaceuticals for the synthesis of certain drugs, polymers for improving rigidity and heat resistance, and as an intermediate in the production of sensors and semiconductors due to its reactivity and chemical stability.

About

CAS No 7158-32-9
English Name 4,4'-Oxydibenzoyl chloride
Molecular Formula C14H8Cl2O3
Molecular Weight 295.12100000000004 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)OC2=CC=C(C=C2)C(=O)Cl
InChIKey OSUWBBMPVXVSOA-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) typically synthesized?

4,4'-Oxydibenzoyl chloride is typically synthesized via the reaction of benzoyl chloride with benzoi...

Compound Q&A

What precautions should be taken when handling 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

Handling 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) requires proper Personal Protective Equipment (...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...