Compound Q&A

How is 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) typically synthesized?

Answer

4,4'-Oxydibenzoyl chloride
4,4'-Oxydibenzoyl chloride is typically synthesized via the reaction of benzoyl chloride with benzoic acid in the presence of a Lewis acid catalyst such as aluminum trichloride (AlCl3) or sulfuric acid (H2SO4). The reaction yields high selectivity and good yields, with the product forming as a white crystalline solid.

About

CAS No 7158-32-9
English Name 4,4'-Oxydibenzoyl chloride
Molecular Formula C14H8Cl2O3
Molecular Weight 295.12100000000004 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)OC2=CC=C(C=C2)C(=O)Cl
InChIKey OSUWBBMPVXVSOA-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) is a white crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) is used in various industries, including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

Handling 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) requires proper Personal Protective Equipment (...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...