Compound Q&A

How is 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) typically synthesized?

Answer

4,4'-Oxydibenzoyl chloride
4,4'-Oxydibenzoyl chloride is typically synthesized via the reaction of benzoyl chloride with benzoic acid in the presence of a Lewis acid catalyst such as aluminum trichloride (AlCl3) or sulfuric acid (H2SO4). The reaction yields high selectivity and good yields, with the product forming as a white crystalline solid.

About

CAS No 7158-32-9
English Name 4,4'-Oxydibenzoyl chloride
Molecular Formula C14H8Cl2O3
Molecular Weight 295.12 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)OC2=CC=C(C=C2)C(=O)Cl
InChIKey OSUWBBMPVXVSOA-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) is a white crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) is used in various industries, including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9)?

Handling 4,4'-Oxydibenzoyl chloride (CAS: 7158-32-9) requires proper Personal Protective Equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...