Compound Q&A

How is 2-Nitroterephthalic acid (CAS: 610-29-7) typically synthesized?

Answer

2-Nitroterephthalic acid
2-Nitroterephthalic acid is commonly synthesized by nitration of terephthalic acid. The process involves the addition of nitric acid and sulfuric acid in the presence of a catalyst like aluminum trichloride. The reaction is typically conducted at low temperatures to control side reactions and improve selectivity. The yield can be up to 90% with proper conditions.

About

CAS No 610-29-7
English Name 2-Nitroterephthalic acid
Molecular Formula C8H5NO6
Molecular Weight 211.13 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C(=O)O
InChIKey QUMITRDILMWWBC-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitroterephthalic acid (CAS: 610-29-7)?

2-Nitroterephthalic acid is a white crystalline solid with a molecular weight of approximately 194.0...

Compound Q&A

What industries use 2-Nitroterephthalic acid (CAS: 610-29-7)?

2-Nitroterephthalic acid finds applications in several industries. It is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 2-Nitroterephthalic acid (CAS: 610-29-7)?

Handling 2-Nitroterephthalic acid requires strict safety measures. Wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...