Compound Q&A

What are the physical and chemical properties of 2-Nitroterephthalic acid (CAS: 610-29-7)?

Answer

2-Nitroterephthalic acid
2-Nitroterephthalic acid is a white crystalline solid with a molecular weight of approximately 194.07 g/mol. It has a pKa of about 2.8 and is slightly soluble in water. The compound is highly reactive due to its aromatic nitro group and carboxylic acid functionality. It is used in various chemical reactions and applications due to its reactivity and stability under certain conditions.

About

CAS No 610-29-7
English Name 2-Nitroterephthalic acid
Molecular Formula C8H5NO6
Molecular Weight 211.13 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C(=O)O
InChIKey QUMITRDILMWWBC-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 2-Nitroterephthalic acid (CAS: 610-29-7) typically synthesized?

2-Nitroterephthalic acid is commonly synthesized by nitration of terephthalic acid. The process invo...

Compound Q&A

What industries use 2-Nitroterephthalic acid (CAS: 610-29-7)?

2-Nitroterephthalic acid finds applications in several industries. It is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 2-Nitroterephthalic acid (CAS: 610-29-7)?

Handling 2-Nitroterephthalic acid requires strict safety measures. Wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...