Compound Q&A

What precautions should be taken when handling tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8)?

Answer

tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate
When handling tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate, it is crucial to use proper personal protective equipment (PPE) such as gloves, lab coat, and safety goggles. Ensure the work is conducted in a well-ventilated area or fume hood. Spills should be cleaned up using appropriate absorbents, and the area should be well-ventilated. Always consult the safety data sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 22426-14-8
English Name tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate
Molecular Formula C12H7BrN2
Molecular Weight 259.11 g/mol
SMILES C1=CC2=C(C3=C(C=C2)C=CC(=N3)Br)N=C1
InChIKey ZRJUDAZGVGIDLP-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8)?

t-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate is a white to off-white crystalline solid with...

Compound Q&A

How is tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8) typically synthesized?

t-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate is typically synthesized via the esterificatio...

Compound Q&A

What industries use tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8)?

t-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate is used in various industries, particularly in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...