Compound Q&A

What are the physical and chemical properties of tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8)?

Answer

tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate
t-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate is a white to off-white crystalline solid with a molecular weight of approximately 287.34 g/mol. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is relatively stable but should be handled under standard organic lab conditions. It exhibits good reactivity in ester formation and can undergo typical organic reactions such as ester hydrolysis and reduction.

About

CAS No 22426-14-8
English Name tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate
Molecular Formula C12H7BrN2
Molecular Weight 259.11 g/mol
SMILES C1=CC2=C(C3=C(C=C2)C=CC(=N3)Br)N=C1
InChIKey ZRJUDAZGVGIDLP-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8) typically synthesized?

t-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate is typically synthesized via the esterificatio...

Compound Q&A

What industries use tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8)?

t-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate is used in various industries, particularly in...

Compound Q&A

What precautions should be taken when handling tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8)?

When handling tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate, it is crucial to use proper ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...