Compound Q&A

What industries use tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8)?

Answer

tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate
t-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate is used in various industries, particularly in pharmaceuticals for the synthesis of drugs and intermediates. It is also employed in the polymer industry for the development of new materials with specific properties. Additionally, it has applications in analytical chemistry as a reagent due to its functional groups.

About

CAS No 22426-14-8
English Name tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate
Molecular Formula C12H7BrN2
Molecular Weight 259.11 g/mol
SMILES C1=CC2=C(C3=C(C=C2)C=CC(=N3)Br)N=C1
InChIKey ZRJUDAZGVGIDLP-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8)?

t-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate is a white to off-white crystalline solid with...

Compound Q&A

How is tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8) typically synthesized?

t-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate is typically synthesized via the esterificatio...

Compound Q&A

What precautions should be taken when handling tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate (CAS: 22426-14-8)?

When handling tert-Butyl 1-(Furan-2-ylmethyl)pyrrolidine-2-carboxylate, it is crucial to use proper ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...