Compound Q&A

What industries use Tozasertib (CAS: 639089-54-6)?

Answer

Tozasertib
Tozasertib, with CAS number 639089-54-6, is primarily used in the pharmaceutical industry for its potential as a cancer therapeutic. It is also explored in the field of biotechnology for its role in modulating cellular signaling pathways. Additionally, it has applications in the development of diagnostic tools and may be used in the polymer industry for its unique chemical properties.

About

English Name Tozasertib
Molecular Formula C23H28N8OS
Molecular Weight 464.6 g/mol
SMILES CC1=CC(=NN1)NC2=CC(=NC(=N2)SC3=CC=C(C=C3)NC(=O)C4CC4)N5CCN(CC5)C
InChIKey GCIKSSRWRFVXBI-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tozasertib (CAS: 639089-54-6)?

Tozasertib, with CAS number 639089-54-6, is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is Tozasertib (CAS: 639089-54-6) typically synthesized?

Tozasertib is synthesized through a multi-step process involving protection, functionalization, and ...

Compound Q&A

What precautions should be taken when handling Tozasertib (CAS: 639089-54-6)?

When handling Tozasertib (CAS: 639089-54-6), it is crucial to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...