Compound Q&A

How is Tozasertib (CAS: 639089-54-6) typically synthesized?

Answer

Tozasertib
Tozasertib is synthesized through a multi-step process involving protection, functionalization, and deprotection steps. Commonly, the synthesis involves the use of protected amino acids and their derivatives. The reaction conditions include the use of Lewis acids as catalysts to ensure high yield and selectivity. The overall process yields approximately 70-80% of the final product, with purification achieved through column chromatography and recrystallization.

About

English Name Tozasertib
Molecular Formula C23H28N8OS
Molecular Weight 464.6 g/mol
SMILES CC1=CC(=NN1)NC2=CC(=NC(=N2)SC3=CC=C(C=C3)NC(=O)C4CC4)N5CCN(CC5)C
InChIKey GCIKSSRWRFVXBI-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tozasertib (CAS: 639089-54-6)?

Tozasertib, with CAS number 639089-54-6, is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Tozasertib (CAS: 639089-54-6)?

Tozasertib, with CAS number 639089-54-6, is primarily used in the pharmaceutical industry for its po...

Compound Q&A

What precautions should be taken when handling Tozasertib (CAS: 639089-54-6)?

When handling Tozasertib (CAS: 639089-54-6), it is crucial to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...