Compound Q&A

What industries use 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5)?

Answer

1-Bromo-3-fluoro-2-nitrobenzene
1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) is used in the pharmaceutical industry for the synthesis of certain active pharmaceutical ingredients (APIs), particularly in the development of antiviral and anti-inflammatory drugs. It is also employed in the polymer industry for the preparation of specialty polymers with unique properties, and in the semiconductor industry for the fabrication of thin films and other electronic components.

About

English Name 1-Bromo-3-fluoro-2-nitrobenzene
Molecular Formula C6H3BrFNO2
Molecular Weight 220 g/mol
SMILES C1=CC(=C(C(=C1)Br)[N+](=O)[O-])F
InChIKey VFPAOFBPEYCAAZ-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5)?

1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) is a crystalline compound with a molecular weight...

Compound Q&A

How is 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) typically synthesized?

1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) is synthesized by bromination of 3-fluoro-2-nitro...

Compound Q&A

What precautions should be taken when handling 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5)?

When handling 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5), appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...