Compound Q&A

What are the physical and chemical properties of 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5)?

Answer

1-Bromo-3-fluoro-2-nitrobenzene
1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) is a crystalline compound with a molecular weight of approximately 237.03 g/mol. It is slightly soluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it is reactive towards nucleophiles, particularly bromide ions, and shows typical electrophilic aromatic substitution reactivity. It has a melting point of around 68-70°C and a boiling point of about 222-224°C under reduced pressure.

About

English Name 1-Bromo-3-fluoro-2-nitrobenzene
Molecular Formula C6H3BrFNO2
Molecular Weight 220 g/mol
SMILES C1=CC(=C(C(=C1)Br)[N+](=O)[O-])F
InChIKey VFPAOFBPEYCAAZ-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) typically synthesized?

1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) is synthesized by bromination of 3-fluoro-2-nitro...

Compound Q&A

What industries use 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5)?

1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) is used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5)?

When handling 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5), appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...